C9H11BrO — CID 69259048
bromomethane;2,3-dihydro-1-benzofuran (PubChem CID 69259048) has the molecular formula C9H11BrO and a molecular weight of 215.09 g/mol. Its IUPAC name is bromomethane;2,3-dihydro-1-benzofuran.
| Compound Name | bromomethane;2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 69259048 |
| Molecular Formula | C9H11BrO |
| Molecular Weight | 215.09 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | bromomethane;2,3-dihydro-1-benzofuran |
| SMILES | CBr.c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C8H8O.CH3Br/c1-2-4-8-7(3-1)5-6-9-8;1-2/h1-4H,5-6H2;1H3 |
| InChIKey | CENOVLYSDOAJJD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.09 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|