C9H11O5P — CID 54141331
3,4-dihydro-2H-chromen-6-yl dihydrogen phosphate (PubChem CID 54141331) has the molecular formula C9H11O5P and a molecular weight of 230.16 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-6-yl dihydrogen phosphate.
| Compound Name | 3,4-dihydro-2H-chromen-6-yl dihydrogen phosphate |
|---|---|
| PubChem CID | 54141331 |
| Molecular Formula | C9H11O5P |
| Molecular Weight | 230.16 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 3,4-dihydro-2H-chromen-6-yl dihydrogen phosphate |
| SMILES | O=P(O)(O)Oc1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C9H11O5P/c10-15(11,12)14-8-3-4-9-7(6-8)2-1-5-13-9/h3-4,6H,1-2,5H2,(H2,10,11,12) |
| InChIKey | OBHUCWWWSYXCPI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.16 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|