C14H18O3 — CID 130250466
3,4-dihydro-2H-chromen-6-yl 2,2-dimethylpropanoate (PubChem CID 130250466) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-6-yl 2,2-dimethylpropanoate.
| Compound Name | 3,4-dihydro-2H-chromen-6-yl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 130250466 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 3,4-dihydro-2H-chromen-6-yl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C14H18O3/c1-14(2,3)13(15)17-11-6-7-12-10(9-11)5-4-8-16-12/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | ZIQDPUVQLNVYKD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|