C15H13NO3S — CID 166216786
3,4-dihydro-2H-chromen-6-yl (E)-3-(1,3-thiazol-5-yl)prop-2-enoate (PubChem CID 166216786) has the molecular formula C15H13NO3S and a molecular weight of 287.34 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-6-yl (E)-3-(1,3-thiazol-5-yl)prop-2-enoate.
| Compound Name | 3,4-dihydro-2H-chromen-6-yl (E)-3-(1,3-thiazol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 166216786 |
| Molecular Formula | C15H13NO3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 3,4-dihydro-2H-chromen-6-yl (E)-3-(1,3-thiazol-5-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cncs1)Oc1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C15H13NO3S/c17-15(6-4-13-9-16-10-20-13)19-12-3-5-14-11(8-12)2-1-7-18-14/h3-6,8-10H,1-2,7H2/b6-4+ |
| InChIKey | ZUCLDDISEZUNBV-GQCTYLIASA-N |
| XLogP | 3.09 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|