C13H14I2NO3- — CID 152806289
CID 152806289 (PubChem CID 152806289) has the molecular formula C13H14I2NO3- and a molecular weight of 486.07 g/mol.
| Compound Name | CID 152806289 |
|---|---|
| PubChem CID | 152806289 |
| Molecular Formula | C13H14I2NO3- |
| Molecular Weight | 486.07 g/mol |
| Exact Mass | 485.91 |
| IUPAC Name | — |
| SMILES | CC(I)(C(=O)Oc1ccc2c(c1)CCCO2)C1N[I-]1 |
| InChI | InChI=1S/C13H14I2NO3/c1-13(14,11-15-16-11)12(17)19-9-4-5-10-8(7-9)3-2-6-18-10/h4-5,7,11,16H,2-3,6H2,1H3/q-1 |
| InChIKey | FBRDQJYBSLHRNN-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 57.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.07 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|