C21H24N2O3 — CID 167777126
3,4-dihydro-2H-chromen-6-yl 2-(4-methylpiperazin-1-yl)benzoate (PubChem CID 167777126) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-6-yl 2-(4-methylpiperazin-1-yl)benzoate.
| Compound Name | 3,4-dihydro-2H-chromen-6-yl 2-(4-methylpiperazin-1-yl)benzoate |
|---|---|
| PubChem CID | 167777126 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 3,4-dihydro-2H-chromen-6-yl 2-(4-methylpiperazin-1-yl)benzoate |
| SMILES | CN1CCN(c2ccccc2C(=O)Oc2ccc3c(c2)CCCO3)CC1 |
| InChI | InChI=1S/C21H24N2O3/c1-22-10-12-23(13-11-22)19-7-3-2-6-18(19)21(24)26-17-8-9-20-16(15-17)5-4-14-25-20/h2-3,6-9,15H,4-5,10-14H2,1H3 |
| InChIKey | MMLWGEPKBVYVNW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|