C21H24N2O2 — CID 110771138
2-(3,4-dihydro-2H-chromen-6-yl)-1-(4-phenylpiperazin-1-yl)ethanone (PubChem CID 110771138) has the molecular formula C21H24N2O2 and a molecular weight of 336.43 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-chromen-6-yl)-1-(4-phenylpiperazin-1-yl)ethanone.
| Compound Name | 2-(3,4-dihydro-2H-chromen-6-yl)-1-(4-phenylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 110771138 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 2-(3,4-dihydro-2H-chromen-6-yl)-1-(4-phenylpiperazin-1-yl)ethanone |
| SMILES | O=C(Cc1ccc2c(c1)CCCO2)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H24N2O2/c24-21(16-17-8-9-20-18(15-17)5-4-14-25-20)23-12-10-22(11-13-23)19-6-2-1-3-7-19/h1-3,6-9,15H,4-5,10-14,16H2 |
| InChIKey | VTUYRTIREDSAMV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |