C16H22N2O2 — CID 96669750
1-(1,4-diazepan-1-yl)-2-(3,4-dihydro-2H-chromen-6-yl)ethanone (PubChem CID 96669750) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-(1,4-diazepan-1-yl)-2-(3,4-dihydro-2H-chromen-6-yl)ethanone.
| Compound Name | 1-(1,4-diazepan-1-yl)-2-(3,4-dihydro-2H-chromen-6-yl)ethanone |
|---|---|
| PubChem CID | 96669750 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-(1,4-diazepan-1-yl)-2-(3,4-dihydro-2H-chromen-6-yl)ethanone |
| SMILES | O=C(Cc1ccc2c(c1)CCCO2)N1CCCNCC1 |
| InChI | InChI=1S/C16H22N2O2/c19-16(18-8-2-6-17-7-9-18)12-13-4-5-15-14(11-13)3-1-10-20-15/h4-5,11,17H,1-3,6-10,12H2 |
| InChIKey | UKUZRTOHULBOEJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |