C11H15ClO3S — CID 123201735
3,4-dihydro-2H-chromene-6-sulfonyl chloride;ethane (PubChem CID 123201735) has the molecular formula C11H15ClO3S and a molecular weight of 262.76 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromene-6-sulfonyl chloride;ethane.
| Compound Name | 3,4-dihydro-2H-chromene-6-sulfonyl chloride;ethane |
|---|---|
| PubChem CID | 123201735 |
| Molecular Formula | C11H15ClO3S |
| Molecular Weight | 262.76 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 3,4-dihydro-2H-chromene-6-sulfonyl chloride;ethane |
| SMILES | CC.O=S(=O)(Cl)c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C9H9ClO3S.C2H6/c10-14(11,12)8-3-4-9-7(6-8)2-1-5-13-9;1-2/h3-4,6H,1-2,5H2;1-2H3 |
| InChIKey | ZGGFNHMNWGWKQZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.76 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |