C18H19NO3S — CID 110705617
2-(3,4-dihydro-2H-chromen-6-ylsulfonyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 110705617) has the molecular formula C18H19NO3S and a molecular weight of 329.42 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-chromen-6-ylsulfonyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(3,4-dihydro-2H-chromen-6-ylsulfonyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 110705617 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2-(3,4-dihydro-2H-chromen-6-ylsulfonyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | O=S(=O)(c1ccc2c(c1)CCCO2)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C18H19NO3S/c20-23(21,17-7-8-18-15(12-17)6-3-11-22-18)19-10-9-14-4-1-2-5-16(14)13-19/h1-2,4-5,7-8,12H,3,6,9-11,13H2 |
| InChIKey | VRCJYRMCQUFTFE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |