C14H20N2O3S — CID 98781188
1-(3,4-dihydro-2H-chromen-6-ylsulfonyl)-1,4-diazepane (PubChem CID 98781188) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-6-ylsulfonyl)-1,4-diazepane.
| Compound Name | 1-(3,4-dihydro-2H-chromen-6-ylsulfonyl)-1,4-diazepane |
|---|---|
| PubChem CID | 98781188 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-6-ylsulfonyl)-1,4-diazepane |
| SMILES | O=S(=O)(c1ccc2c(c1)CCCO2)N1CCCNCC1 |
| InChI | InChI=1S/C14H20N2O3S/c17-20(18,16-8-2-6-15-7-9-16)13-4-5-14-12(11-13)3-1-10-19-14/h4-5,11,15H,1-3,6-10H2 |
| InChIKey | BTPLJIKJLRWRLC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |