C14H20N2O4S — CID 43362279
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-1,4-diazepane (PubChem CID 43362279) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-1,4-diazepane.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-1,4-diazepane |
|---|---|
| PubChem CID | 43362279 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-1,4-diazepane |
| SMILES | O=S(=O)(c1ccc2c(c1)OCCCO2)N1CCCNCC1 |
| InChI | InChI=1S/C14H20N2O4S/c17-21(18,16-7-1-5-15-6-8-16)12-3-4-13-14(11-12)20-10-2-9-19-13/h3-4,11,15H,1-2,5-10H2 |
| InChIKey | KHMXUALEBVGKGI-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |