C14H18N2O5S — CID 110757540
4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)piperazine-1-carbaldehyde (PubChem CID 110757540) has the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)piperazine-1-carbaldehyde.
| Compound Name | 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 110757540 |
| Molecular Formula | C14H18N2O5S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(S(=O)(=O)c2ccc3c(c2)OCCCO3)CC1 |
| InChI | InChI=1S/C14H18N2O5S/c17-11-15-4-6-16(7-5-15)22(18,19)12-2-3-13-14(10-12)21-9-1-8-20-13/h2-3,10-11H,1,4-9H2 |
| InChIKey | HTJWRWRRIJIQPO-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|