C18H27N2O4S+ — CID 8621688
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-4-(3-methylbut-2-enyl)piperazin-4-ium (PubChem CID 8621688) has the molecular formula C18H27N2O4S+ and a molecular weight of 367.49 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-4-(3-methylbut-2-enyl)piperazin-4-ium.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-4-(3-methylbut-2-enyl)piperazin-4-ium |
|---|---|
| PubChem CID | 8621688 |
| Molecular Formula | C18H27N2O4S+ |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-4-(3-methylbut-2-enyl)piperazin-4-ium |
| SMILES | CC(C)=CC[NH+]1CCN(S(=O)(=O)c2ccc3c(c2)OCCCO3)CC1 |
| InChI | InChI=1S/C18H26N2O4S/c1-15(2)6-7-19-8-10-20(11-9-19)25(21,22)16-4-5-17-18(14-16)24-13-3-12-23-17/h4-6,14H,3,7-13H2,1-2H3/p+1 |
| InChIKey | KANOCJFVNCSWDR-UHFFFAOYSA-O |
| XLogP | 0.70 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|