C17H27N2O2S+ — CID 8691169
1-(3,4-dimethylphenyl)sulfonyl-4-(3-methylbut-2-enyl)piperazin-4-ium (PubChem CID 8691169) has the molecular formula C17H27N2O2S+ and a molecular weight of 323.48 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)sulfonyl-4-(3-methylbut-2-enyl)piperazin-4-ium.
| Compound Name | 1-(3,4-dimethylphenyl)sulfonyl-4-(3-methylbut-2-enyl)piperazin-4-ium |
|---|---|
| PubChem CID | 8691169 |
| Molecular Formula | C17H27N2O2S+ |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 1-(3,4-dimethylphenyl)sulfonyl-4-(3-methylbut-2-enyl)piperazin-4-ium |
| SMILES | CC(C)=CC[NH+]1CCN(S(=O)(=O)c2ccc(C)c(C)c2)CC1 |
| InChI | InChI=1S/C17H26N2O2S/c1-14(2)7-8-18-9-11-19(12-10-18)22(20,21)17-6-5-15(3)16(4)13-17/h5-7,13H,8-12H2,1-4H3/p+1 |
| InChIKey | GNZLKMDMMSYZHT-UHFFFAOYSA-O |
| XLogP | 1.16 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|