C15H21ClFN2O2S+ — CID 8680890
1-(3-chloro-4-fluorophenyl)sulfonyl-4-(3-methylbut-2-enyl)piperazin-4-ium (PubChem CID 8680890) has the molecular formula C15H21ClFN2O2S+ and a molecular weight of 347.86 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)sulfonyl-4-(3-methylbut-2-enyl)piperazin-4-ium.
| Compound Name | 1-(3-chloro-4-fluorophenyl)sulfonyl-4-(3-methylbut-2-enyl)piperazin-4-ium |
|---|---|
| PubChem CID | 8680890 |
| Molecular Formula | C15H21ClFN2O2S+ |
| Molecular Weight | 347.86 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)sulfonyl-4-(3-methylbut-2-enyl)piperazin-4-ium |
| SMILES | CC(C)=CC[NH+]1CCN(S(=O)(=O)c2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H20ClFN2O2S/c1-12(2)5-6-18-7-9-19(10-8-18)22(20,21)13-3-4-15(17)14(16)11-13/h3-5,11H,6-10H2,1-2H3/p+1 |
| InChIKey | BPAJFXSKHJRHIG-UHFFFAOYSA-O |
| XLogP | 1.33 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.86 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|