C16H22F3N2O2S+ — CID 8597936
1-(3-methylbut-2-enyl)-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-ium (PubChem CID 8597936) has the molecular formula C16H22F3N2O2S+ and a molecular weight of 363.43 g/mol. Its IUPAC name is 1-(3-methylbut-2-enyl)-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-ium.
| Compound Name | 1-(3-methylbut-2-enyl)-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 8597936 |
| Molecular Formula | C16H22F3N2O2S+ |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 1-(3-methylbut-2-enyl)-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-ium |
| SMILES | CC(C)=CC[NH+]1CCN(S(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H21F3N2O2S/c1-13(2)7-8-20-9-11-21(12-10-20)24(22,23)15-5-3-14(4-6-15)16(17,18)19/h3-7H,8-12H2,1-2H3/p+1 |
| InChIKey | JJQVRAKYPSBLOT-UHFFFAOYSA-O |
| XLogP | 1.56 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|