C13H16ClFN3O2S+ — CID 9349041
(2R)-2-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]propanenitrile (PubChem CID 9349041) has the molecular formula C13H16ClFN3O2S+ and a molecular weight of 332.81 g/mol. Its IUPAC name is (2R)-2-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]propanenitrile.
| Compound Name | (2R)-2-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]propanenitrile |
|---|---|
| PubChem CID | 9349041 |
| Molecular Formula | C13H16ClFN3O2S+ |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | (2R)-2-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]propanenitrile |
| SMILES | C[C@H](C#N)[NH+]1CCN(S(=O)(=O)c2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C13H15ClFN3O2S/c1-10(9-16)17-4-6-18(7-5-17)21(19,20)11-2-3-13(15)12(14)8-11/h2-3,8,10H,4-7H2,1H3/p+1/t10-/m1/s1 |
| InChIKey | DKRZYVUBZSTGGF-SNVBAGLBSA-O |
| XLogP | 0.28 |
| TPSA | 65.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |