C20H24N2O7S2 — CID 25376332
N-(2-hydroxy-5-piperidin-1-ylsulfonylphenyl)-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide (PubChem CID 25376332) has the molecular formula C20H24N2O7S2 and a molecular weight of 468.55 g/mol. Its IUPAC name is N-(2-hydroxy-5-piperidin-1-ylsulfonylphenyl)-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide.
| Compound Name | N-(2-hydroxy-5-piperidin-1-ylsulfonylphenyl)-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide |
|---|---|
| PubChem CID | 25376332 |
| Molecular Formula | C20H24N2O7S2 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | N-(2-hydroxy-5-piperidin-1-ylsulfonylphenyl)-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(S(=O)(=O)N2CCCCC2)ccc1O)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C20H24N2O7S2/c23-18-7-5-16(31(26,27)22-9-2-1-3-10-22)13-17(18)21-30(24,25)15-6-8-19-20(14-15)29-12-4-11-28-19/h5-8,13-14,21,23H,1-4,9-12H2 |
| InChIKey | SEKSVHWQCXECAR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|