C23H28ClN3O5S — CID 41170607
(2R)-N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)propanamide (PubChem CID 41170607) has the molecular formula C23H28ClN3O5S and a molecular weight of 494.01 g/mol. Its IUPAC name is (2R)-N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)propanamide.
| Compound Name | (2R)-N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)propanamide |
|---|---|
| PubChem CID | 41170607 |
| Molecular Formula | C23H28ClN3O5S |
| Molecular Weight | 494.01 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | (2R)-N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)propanamide |
| SMILES | C[C@@H](Nc1ccc2c(c1)OCCCO2)C(=O)Nc1cc(S(=O)(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C23H28ClN3O5S/c1-16(25-17-6-9-21-22(14-17)32-13-5-12-31-21)23(28)26-20-15-18(7-8-19(20)24)33(29,30)27-10-3-2-4-11-27/h6-9,14-16,25H,2-5,10-13H2,1H3,(H,26,28)/t16-/m1/s1 |
| InChIKey | KBHQESGAYUSAOE-MRXNPFEDSA-N |
| XLogP | 4.11 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.01 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|