C18H19ClN2O3 — CID 51242254
N-(3-chloro-2-methylphenyl)-2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanamide (PubChem CID 51242254) has the molecular formula C18H19ClN2O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanamide |
|---|---|
| PubChem CID | 51242254 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)C(C)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H19ClN2O3/c1-11-14(19)4-3-5-15(11)21-18(22)12(2)20-13-6-7-16-17(10-13)24-9-8-23-16/h3-7,10,12,20H,8-9H2,1-2H3,(H,21,22) |
| InChIKey | DNGAZJOVUOYBMJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|