C16H15ClN2O3 — CID 109008524
2-(1,3-benzodioxol-5-ylamino)-N-(3-chloro-2-methylphenyl)acetamide (PubChem CID 109008524) has the molecular formula C16H15ClN2O3 and a molecular weight of 318.76 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylamino)-N-(3-chloro-2-methylphenyl)acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylamino)-N-(3-chloro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 109008524 |
| Molecular Formula | C16H15ClN2O3 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylamino)-N-(3-chloro-2-methylphenyl)acetamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CNc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H15ClN2O3/c1-10-12(17)3-2-4-13(10)19-16(20)8-18-11-5-6-14-15(7-11)22-9-21-14/h2-7,18H,8-9H2,1H3,(H,19,20) |
| InChIKey | VMKCRCPRTMZUAS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|