C18H27ClN3O3S+ — CID 7858760
(2R)-N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-2-pyrrolidin-1-ium-1-ylpropanamide (PubChem CID 7858760) has the molecular formula C18H27ClN3O3S+ and a molecular weight of 400.95 g/mol. Its IUPAC name is (2R)-N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-2-pyrrolidin-1-ium-1-ylpropanamide.
| Compound Name | (2R)-N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-2-pyrrolidin-1-ium-1-ylpropanamide |
|---|---|
| PubChem CID | 7858760 |
| Molecular Formula | C18H27ClN3O3S+ |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (2R)-N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-2-pyrrolidin-1-ium-1-ylpropanamide |
| SMILES | C[C@H](C(=O)Nc1cc(S(=O)(=O)N2CCCCC2)ccc1Cl)[NH+]1CCCC1 |
| InChI | InChI=1S/C18H26ClN3O3S/c1-14(21-9-5-6-10-21)18(23)20-17-13-15(7-8-16(17)19)26(24,25)22-11-3-2-4-12-22/h7-8,13-14H,2-6,9-12H2,1H3,(H,20,23)/p+1/t14-/m1/s1 |
| InChIKey | LRQMDJSZSAPPOY-CQSZACIVSA-O |
| XLogP | 1.52 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |