C18H21ClN4O3S2 — CID 17443656
N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-2-pyrimidin-2-ylsulfanylpropanamide (PubChem CID 17443656) has the molecular formula C18H21ClN4O3S2 and a molecular weight of 440.98 g/mol. Its IUPAC name is N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-2-pyrimidin-2-ylsulfanylpropanamide.
| Compound Name | N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-2-pyrimidin-2-ylsulfanylpropanamide |
|---|---|
| PubChem CID | 17443656 |
| Molecular Formula | C18H21ClN4O3S2 |
| Molecular Weight | 440.98 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-2-pyrimidin-2-ylsulfanylpropanamide |
| SMILES | CC(Sc1ncccn1)C(=O)Nc1cc(S(=O)(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C18H21ClN4O3S2/c1-13(27-18-20-8-5-9-21-18)17(24)22-16-12-14(6-7-15(16)19)28(25,26)23-10-3-2-4-11-23/h5-9,12-13H,2-4,10-11H2,1H3,(H,22,24) |
| InChIKey | CYJBLBQOLDOOPN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.98 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |