C13H11Cl2N3OS — CID 18075928
N-(2,5-dichlorophenyl)-2-pyrimidin-2-ylsulfanylpropanamide (PubChem CID 18075928) has the molecular formula C13H11Cl2N3OS and a molecular weight of 328.22 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-pyrimidin-2-ylsulfanylpropanamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-pyrimidin-2-ylsulfanylpropanamide |
|---|---|
| PubChem CID | 18075928 |
| Molecular Formula | C13H11Cl2N3OS |
| Molecular Weight | 328.22 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-pyrimidin-2-ylsulfanylpropanamide |
| SMILES | CC(Sc1ncccn1)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H11Cl2N3OS/c1-8(20-13-16-5-2-6-17-13)12(19)18-11-7-9(14)3-4-10(11)15/h2-8H,1H3,(H,18,19) |
| InChIKey | FGGGKGWHJOIEJD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.22 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |