C14H12Cl2N2OS — CID 16530287
N-(2,5-dichlorophenyl)-2-pyridin-2-ylsulfanylpropanamide (PubChem CID 16530287) has the molecular formula C14H12Cl2N2OS and a molecular weight of 327.24 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-pyridin-2-ylsulfanylpropanamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-pyridin-2-ylsulfanylpropanamide |
|---|---|
| PubChem CID | 16530287 |
| Molecular Formula | C14H12Cl2N2OS |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-pyridin-2-ylsulfanylpropanamide |
| SMILES | CC(Sc1ccccn1)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H12Cl2N2OS/c1-9(20-13-4-2-3-7-17-13)14(19)18-12-8-10(15)5-6-11(12)16/h2-9H,1H3,(H,18,19) |
| InChIKey | KMORSHFYFGVWBD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |