C15H13F3N2OS — CID 51234179
2-pyridin-2-ylsulfanyl-N-[2-(trifluoromethyl)phenyl]propanamide (PubChem CID 51234179) has the molecular formula C15H13F3N2OS and a molecular weight of 326.34 g/mol. Its IUPAC name is 2-pyridin-2-ylsulfanyl-N-[2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-pyridin-2-ylsulfanyl-N-[2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 51234179 |
| Molecular Formula | C15H13F3N2OS |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 2-pyridin-2-ylsulfanyl-N-[2-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(Sc1ccccn1)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H13F3N2OS/c1-10(22-13-8-4-5-9-19-13)14(21)20-12-7-3-2-6-11(12)15(16,17)18/h2-10H,1H3,(H,20,21) |
| InChIKey | FZZUHISEVFODMQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |