C20H25ClN2O5S — CID 16525227
[1-(2-chloro-5-piperidin-1-ylsulfonylanilino)-1-oxopropan-2-yl] (2E,4E)-hexa-2,4-dienoate (PubChem CID 16525227) has the molecular formula C20H25ClN2O5S and a molecular weight of 440.95 g/mol. Its IUPAC name is [1-(2-chloro-5-piperidin-1-ylsulfonylanilino)-1-oxopropan-2-yl] (2E,4E)-hexa-2,4-dienoate.
| Compound Name | [1-(2-chloro-5-piperidin-1-ylsulfonylanilino)-1-oxopropan-2-yl] (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 16525227 |
| Molecular Formula | C20H25ClN2O5S |
| Molecular Weight | 440.95 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | [1-(2-chloro-5-piperidin-1-ylsulfonylanilino)-1-oxopropan-2-yl] (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)OC(C)C(=O)Nc1cc(S(=O)(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C20H25ClN2O5S/c1-3-4-6-9-19(24)28-15(2)20(25)22-18-14-16(10-11-17(18)21)29(26,27)23-12-7-5-8-13-23/h3-4,6,9-11,14-15H,5,7-8,12-13H2,1-2H3,(H,22,25)/b4-3+,9-6+ |
| InChIKey | LEZIDINFDFHDRP-JAFPNSLJSA-N |
| XLogP | 3.52 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.95 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|