C21H22ClFN2O5S — CID 26450714
[(2S)-1-(2-chloro-5-piperidin-1-ylsulfonylanilino)-1-oxopropan-2-yl] 3-fluorobenzoate (PubChem CID 26450714) has the molecular formula C21H22ClFN2O5S and a molecular weight of 468.93 g/mol. Its IUPAC name is [(2S)-1-(2-chloro-5-piperidin-1-ylsulfonylanilino)-1-oxopropan-2-yl] 3-fluorobenzoate.
| Compound Name | [(2S)-1-(2-chloro-5-piperidin-1-ylsulfonylanilino)-1-oxopropan-2-yl] 3-fluorobenzoate |
|---|---|
| PubChem CID | 26450714 |
| Molecular Formula | C21H22ClFN2O5S |
| Molecular Weight | 468.93 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | [(2S)-1-(2-chloro-5-piperidin-1-ylsulfonylanilino)-1-oxopropan-2-yl] 3-fluorobenzoate |
| SMILES | C[C@H](OC(=O)c1cccc(F)c1)C(=O)Nc1cc(S(=O)(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C21H22ClFN2O5S/c1-14(30-21(27)15-6-5-7-16(23)12-15)20(26)24-19-13-17(8-9-18(19)22)31(28,29)25-10-3-2-4-11-25/h5-9,12-14H,2-4,10-11H2,1H3,(H,24,26)/t14-/m0/s1 |
| InChIKey | WSDQXCMHNHEZLJ-AWEZNQCLSA-N |
| XLogP | 3.84 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.93 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |