C24H26F2N2O5S — CID 55419173
[1-(2,4-difluoroanilino)-1-oxopropan-2-yl] (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate (PubChem CID 55419173) has the molecular formula C24H26F2N2O5S and a molecular weight of 492.54 g/mol. Its IUPAC name is [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate.
| Compound Name | [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 55419173 |
| Molecular Formula | C24H26F2N2O5S |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate |
| SMILES | CC(OC(=O)/C=C/c1ccc(S(=O)(=O)N2CCCCCC2)cc1)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C24H26F2N2O5S/c1-17(24(30)27-22-12-9-19(25)16-21(22)26)33-23(29)13-8-18-6-10-20(11-7-18)34(31,32)28-14-4-2-3-5-15-28/h6-13,16-17H,2-5,14-15H2,1H3,(H,27,30)/b13-8+ |
| InChIKey | CMABESYNPZUAED-MDWZMJQESA-N |
| XLogP | 4.11 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|