C21H28N2O5S — CID 7649305
[(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate (PubChem CID 7649305) has the molecular formula C21H28N2O5S and a molecular weight of 420.53 g/mol. Its IUPAC name is [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate.
| Compound Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7649305 |
| Molecular Formula | C21H28N2O5S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1ccc(S(=O)(=O)N2CCCCCC2)cc1)C(=O)NC1CC1 |
| InChI | InChI=1S/C21H28N2O5S/c1-16(21(25)22-18-9-10-18)28-20(24)13-8-17-6-11-19(12-7-17)29(26,27)23-14-4-2-3-5-15-23/h6-8,11-13,16,18H,2-5,9-10,14-15H2,1H3,(H,22,25)/b13-8+/t16-/m0/s1 |
| InChIKey | RWJXRDYQOOWRKB-OIQJVACTSA-N |
| XLogP | 2.47 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|