C22H24F2N2O5S — CID 55416969
[1-(2,4-difluoroanilino)-1-oxopropan-2-yl] (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate (PubChem CID 55416969) has the molecular formula C22H24F2N2O5S and a molecular weight of 466.51 g/mol. Its IUPAC name is [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate.
| Compound Name | [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 55416969 |
| Molecular Formula | C22H24F2N2O5S |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(/C=C/C(=O)OC(C)C(=O)Nc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C22H24F2N2O5S/c1-4-26(5-2)32(29,30)18-10-6-16(7-11-18)8-13-21(27)31-15(3)22(28)25-20-12-9-17(23)14-19(20)24/h6-15H,4-5H2,1-3H3,(H,25,28)/b13-8+ |
| InChIKey | OSYUZVJYFNXLDP-MDWZMJQESA-N |
| XLogP | 3.58 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|