C19H17NO2S — CID 808079
2-naphthalen-2-ylsulfonyl-3,4-dihydro-1H-isoquinoline (PubChem CID 808079) has the molecular formula C19H17NO2S and a molecular weight of 323.42 g/mol. Its IUPAC name is 2-naphthalen-2-ylsulfonyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-naphthalen-2-ylsulfonyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 808079 |
| Molecular Formula | C19H17NO2S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 2-naphthalen-2-ylsulfonyl-3,4-dihydro-1H-isoquinoline |
| SMILES | O=S(=O)(c1ccc2ccccc2c1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C19H17NO2S/c21-23(22,19-10-9-15-5-1-3-7-17(15)13-19)20-12-11-16-6-2-4-8-18(16)14-20/h1-10,13H,11-12,14H2 |
| InChIKey | YKYRSCGKTATARM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |