C16H16BrNO3S — CID 112770544
2-(4-bromo-3-methoxyphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline (PubChem CID 112770544) has the molecular formula C16H16BrNO3S and a molecular weight of 382.28 g/mol. Its IUPAC name is 2-(4-bromo-3-methoxyphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(4-bromo-3-methoxyphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 112770544 |
| Molecular Formula | C16H16BrNO3S |
| Molecular Weight | 382.28 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | 2-(4-bromo-3-methoxyphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1cc(S(=O)(=O)N2CCc3ccccc3C2)ccc1Br |
| InChI | InChI=1S/C16H16BrNO3S/c1-21-16-10-14(6-7-15(16)17)22(19,20)18-9-8-12-4-2-3-5-13(12)11-18/h2-7,10H,8-9,11H2,1H3 |
| InChIKey | CLBKSEUUHGSUHT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |