C17H18BrNO4S — CID 3750648
2-(2-bromophenyl)sulfonyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline (PubChem CID 3750648) has the molecular formula C17H18BrNO4S and a molecular weight of 412.31 g/mol. Its IUPAC name is 2-(2-bromophenyl)sulfonyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(2-bromophenyl)sulfonyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 3750648 |
| Molecular Formula | C17H18BrNO4S |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | 2-(2-bromophenyl)sulfonyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1cc2c(cc1OC)CN(S(=O)(=O)c1ccccc1Br)CC2 |
| InChI | InChI=1S/C17H18BrNO4S/c1-22-15-9-12-7-8-19(11-13(12)10-16(15)23-2)24(20,21)17-6-4-3-5-14(17)18/h3-6,9-10H,7-8,11H2,1-2H3 |
| InChIKey | CUMDGBUJRJLAPV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |