C12H16ClNO4S — CID 55246587
2-(chloromethylsulfonyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline (PubChem CID 55246587) has the molecular formula C12H16ClNO4S and a molecular weight of 305.78 g/mol. Its IUPAC name is 2-(chloromethylsulfonyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(chloromethylsulfonyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 55246587 |
| Molecular Formula | C12H16ClNO4S |
| Molecular Weight | 305.78 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 2-(chloromethylsulfonyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1cc2c(cc1OC)CN(S(=O)(=O)CCl)CC2 |
| InChI | InChI=1S/C12H16ClNO4S/c1-17-11-5-9-3-4-14(19(15,16)8-13)7-10(9)6-12(11)18-2/h5-6H,3-4,7-8H2,1-2H3 |
| InChIKey | MJRCTVKBFGYAJR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.78 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|