C16H24N2O8S — CID 87408223
N-[(2S)-1-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-4,4-dihydroxybutan-2-yl]-N-hydroxyformamide (PubChem CID 87408223) has the molecular formula C16H24N2O8S and a molecular weight of 404.44 g/mol. Its IUPAC name is N-[(2S)-1-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-4,4-dihydroxybutan-2-yl]-N-hydroxyformamide.
| Compound Name | N-[(2S)-1-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-4,4-dihydroxybutan-2-yl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 87408223 |
| Molecular Formula | C16H24N2O8S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | N-[(2S)-1-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-4,4-dihydroxybutan-2-yl]-N-hydroxyformamide |
| SMILES | COc1cc2c(cc1OC)CN(S(=O)(=O)C[C@H](CC(O)O)N(O)C=O)CC2 |
| InChI | InChI=1S/C16H24N2O8S/c1-25-14-5-11-3-4-17(8-12(11)6-15(14)26-2)27(23,24)9-13(7-16(20)21)18(22)10-19/h5-6,10,13,16,20-22H,3-4,7-9H2,1-2H3/t13-/m0/s1 |
| InChIKey | YOPVCJAUAMMFSD-ZDUSSCGKSA-N |
| XLogP | -0.69 |
| TPSA | 136.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|