C22H28N2O6S — CID 16659953
N-[1-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-4-phenylbutan-2-yl]-N-hydroxyformamide (PubChem CID 16659953) has the molecular formula C22H28N2O6S and a molecular weight of 448.54 g/mol. Its IUPAC name is N-[1-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-4-phenylbutan-2-yl]-N-hydroxyformamide.
| Compound Name | N-[1-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-4-phenylbutan-2-yl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 16659953 |
| Molecular Formula | C22H28N2O6S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | N-[1-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-4-phenylbutan-2-yl]-N-hydroxyformamide |
| SMILES | COc1cc2c(cc1OC)CN(S(=O)(=O)CC(CCc1ccccc1)N(O)C=O)CC2 |
| InChI | InChI=1S/C22H28N2O6S/c1-29-21-12-18-10-11-23(14-19(18)13-22(21)30-2)31(27,28)15-20(24(26)16-25)9-8-17-6-4-3-5-7-17/h3-7,12-13,16,20,26H,8-11,14-15H2,1-2H3 |
| InChIKey | HJJCNHRDJSHQMJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|