C27H30N2O3 — CID 87976529
(2S)-2-[benzyl-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)amino]-3-phenylpropanal (PubChem CID 87976529) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is (2S)-2-[benzyl-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)amino]-3-phenylpropanal.
| Compound Name | (2S)-2-[benzyl-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)amino]-3-phenylpropanal |
|---|---|
| PubChem CID | 87976529 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | (2S)-2-[benzyl-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)amino]-3-phenylpropanal |
| SMILES | COc1cc2c(cc1OC)CN(N(Cc1ccccc1)[C@H](C=O)Cc1ccccc1)CC2 |
| InChI | InChI=1S/C27H30N2O3/c1-31-26-16-23-13-14-28(19-24(23)17-27(26)32-2)29(18-22-11-7-4-8-12-22)25(20-30)15-21-9-5-3-6-10-21/h3-12,16-17,20,25H,13-15,18-19H2,1-2H3/t25-/m0/s1 |
| InChIKey | GQJJIQVUZQVDKV-VWLOTQADSA-N |
| XLogP | 4.29 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|