C10H12ClNO3S — CID 63665780
2-(chloromethylsulfonyl)-3,4-dihydro-1H-isoquinolin-7-ol (PubChem CID 63665780) has the molecular formula C10H12ClNO3S and a molecular weight of 261.73 g/mol. Its IUPAC name is 2-(chloromethylsulfonyl)-3,4-dihydro-1H-isoquinolin-7-ol.
| Compound Name | 2-(chloromethylsulfonyl)-3,4-dihydro-1H-isoquinolin-7-ol |
|---|---|
| PubChem CID | 63665780 |
| Molecular Formula | C10H12ClNO3S |
| Molecular Weight | 261.73 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 2-(chloromethylsulfonyl)-3,4-dihydro-1H-isoquinolin-7-ol |
| SMILES | O=S(=O)(CCl)N1CCc2ccc(O)cc2C1 |
| InChI | InChI=1S/C10H12ClNO3S/c11-7-16(14,15)12-4-3-8-1-2-10(13)5-9(8)6-12/h1-2,5,13H,3-4,6-7H2 |
| InChIKey | SEBAPJXYAJWVJX-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.73 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|