C24H30N2O2 — CID 166186847
3-[(E)-4-(7-hydroxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)but-2-enyl]-1,2,4,5-tetrahydro-3-benzazepin-7-ol (PubChem CID 166186847) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 3-[(E)-4-(7-hydroxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)but-2-enyl]-1,2,4,5-tetrahydro-3-benzazepin-7-ol.
| Compound Name | 3-[(E)-4-(7-hydroxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)but-2-enyl]-1,2,4,5-tetrahydro-3-benzazepin-7-ol |
|---|---|
| PubChem CID | 166186847 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 3-[(E)-4-(7-hydroxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)but-2-enyl]-1,2,4,5-tetrahydro-3-benzazepin-7-ol |
| SMILES | Oc1ccc2c(c1)CCN(C/C=C/CN1CCc3ccc(O)cc3CC1)CC2 |
| InChI | InChI=1S/C24H30N2O2/c27-23-5-3-19-7-13-25(15-9-21(19)17-23)11-1-2-12-26-14-8-20-4-6-24(28)18-22(20)10-16-26/h1-6,17-18,27-28H,7-16H2/b2-1+ |
| InChIKey | ZODAOLFSNXEDGL-OWOJBTEDSA-N |
| XLogP | 3.16 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|