C9H12NOP — CID 59950877
2-phosphanyl-3,4-dihydro-1H-isoquinolin-6-ol (PubChem CID 59950877) has the molecular formula C9H12NOP and a molecular weight of 181.18 g/mol. Its IUPAC name is 2-phosphanyl-3,4-dihydro-1H-isoquinolin-6-ol.
| Compound Name | 2-phosphanyl-3,4-dihydro-1H-isoquinolin-6-ol |
|---|---|
| PubChem CID | 59950877 |
| Molecular Formula | C9H12NOP |
| Molecular Weight | 181.18 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 2-phosphanyl-3,4-dihydro-1H-isoquinolin-6-ol |
| SMILES | Oc1ccc2c(c1)CCN(P)C2 |
| InChI | InChI=1S/C9H12NOP/c11-9-2-1-8-6-10(12)4-3-7(8)5-9/h1-2,5,11H,3-4,6,12H2 |
| InChIKey | HCPUGJMRBSKEOQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.18 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|