C10H14NOP — CID 90944777
(2-phosphanyl-3,4-dihydro-1H-isoquinolin-6-yl)methanol (PubChem CID 90944777) has the molecular formula C10H14NOP and a molecular weight of 195.20 g/mol. Its IUPAC name is (2-phosphanyl-3,4-dihydro-1H-isoquinolin-6-yl)methanol.
| Compound Name | (2-phosphanyl-3,4-dihydro-1H-isoquinolin-6-yl)methanol |
|---|---|
| PubChem CID | 90944777 |
| Molecular Formula | C10H14NOP |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | (2-phosphanyl-3,4-dihydro-1H-isoquinolin-6-yl)methanol |
| SMILES | OCc1ccc2c(c1)CCN(P)C2 |
| InChI | InChI=1S/C10H14NOP/c12-7-8-1-2-10-6-11(13)4-3-9(10)5-8/h1-2,5,12H,3-4,6-7,13H2 |
| InChIKey | OCBMTSMNWRMPJE-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|