About (1-propan-2-yl-2,3-dihydroindol-5-yl)methanol
(1-propan-2-yl-2,3-dihydroindol-5-yl)methanol (PubChem CID 115114830) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is (1-propan-2-yl-2,3-dihydroindol-5-yl)methanol.
Molecular Properties
| Compound Name | (1-propan-2-yl-2,3-dihydroindol-5-yl)methanol |
| PubChem CID | 115114830 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (1-propan-2-yl-2,3-dihydroindol-5-yl)methanol |
| SMILES | CC(C)N1CCc2cc(CO)ccc21 |
| InChI | InChI=1S/C12H17NO/c1-9(2)13-6-5-11-7-10(8-14)3-4-12(11)13/h3-4,7,9,14H,5-6,8H2,1-2H3 |
| InChIKey | QLJNPNHRUTVHMR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze (1-propan-2-yl-2,3-dihydroindol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-propan-2-yl-2,3-dihydroindol-5-yl)methanol?
The IUPAC name of (1-propan-2-yl-2,3-dihydroindol-5-yl)methanol (CID 115114830) is (1-propan-2-yl-2,3-dihydroindol-5-yl)methanol.
What is the SMILES notation for (1-propan-2-yl-2,3-dihydroindol-5-yl)methanol?
The canonical SMILES for (1-propan-2-yl-2,3-dihydroindol-5-yl)methanol is CC(C)N1CCc2cc(CO)ccc21.
What is the InChIKey of (1-propan-2-yl-2,3-dihydroindol-5-yl)methanol?
The InChIKey is QLJNPNHRUTVHMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-9(2)13-6-5-11-7-10(8-14)3-4-12(11)13/h3-4,7,9,14H,5-6,8H2,1-2H3.
What are the key properties of (1-propan-2-yl-2,3-dihydroindol-5-yl)methanol?
(1-propan-2-yl-2,3-dihydroindol-5-yl)methanol has a molecular weight of 191.27 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-propan-2-yl-2,3-dihydroindol-5-yl)methanol is sourced from PubChem (CID 115114830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).