C15H21NO2 — CID 115105876
2-methyl-3-(1-propan-2-yl-2,3-dihydroindol-6-yl)propanoic acid (PubChem CID 115105876) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-methyl-3-(1-propan-2-yl-2,3-dihydroindol-6-yl)propanoic acid.
| Compound Name | 2-methyl-3-(1-propan-2-yl-2,3-dihydroindol-6-yl)propanoic acid |
|---|---|
| PubChem CID | 115105876 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 2-methyl-3-(1-propan-2-yl-2,3-dihydroindol-6-yl)propanoic acid |
| SMILES | CC(Cc1ccc2c(c1)N(C(C)C)CC2)C(=O)O |
| InChI | InChI=1S/C15H21NO2/c1-10(2)16-7-6-13-5-4-12(9-14(13)16)8-11(3)15(17)18/h4-5,9-11H,6-8H2,1-3H3,(H,17,18) |
| InChIKey | AWDDYYJSGWFEEU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |