C14H21NO — CID 115105893
2-[1-(2-methylpropyl)-2,3-dihydroindol-5-yl]ethanol (PubChem CID 115105893) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 2-[1-(2-methylpropyl)-2,3-dihydroindol-5-yl]ethanol.
| Compound Name | 2-[1-(2-methylpropyl)-2,3-dihydroindol-5-yl]ethanol |
|---|---|
| PubChem CID | 115105893 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 2-[1-(2-methylpropyl)-2,3-dihydroindol-5-yl]ethanol |
| SMILES | CC(C)CN1CCc2cc(CCO)ccc21 |
| InChI | InChI=1S/C14H21NO/c1-11(2)10-15-7-5-13-9-12(6-8-16)3-4-14(13)15/h3-4,9,11,16H,5-8,10H2,1-2H3 |
| InChIKey | ZYGSRFDXCTYEJO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |