C19H22BrN3 — CID 102246990
(4-bromophenyl)-[1-(2-methylpropyl)-3,4-dihydro-2H-quinolin-6-yl]diazene (PubChem CID 102246990) has the molecular formula C19H22BrN3 and a molecular weight of 372.31 g/mol. Its IUPAC name is (4-bromophenyl)-[1-(2-methylpropyl)-3,4-dihydro-2H-quinolin-6-yl]diazene.
| Compound Name | (4-bromophenyl)-[1-(2-methylpropyl)-3,4-dihydro-2H-quinolin-6-yl]diazene |
|---|---|
| PubChem CID | 102246990 |
| Molecular Formula | C19H22BrN3 |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | (4-bromophenyl)-[1-(2-methylpropyl)-3,4-dihydro-2H-quinolin-6-yl]diazene |
| SMILES | CC(C)CN1CCCc2cc(/N=N/c3ccc(Br)cc3)ccc21 |
| InChI | InChI=1S/C19H22BrN3/c1-14(2)13-23-11-3-4-15-12-18(9-10-19(15)23)22-21-17-7-5-16(20)6-8-17/h5-10,12,14H,3-4,11,13H2,1-2H3/b22-21+ |
| InChIKey | CZWCVNKFTJZHPQ-QURGRASLSA-N |
| XLogP | 6.27 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|