C15H14BrN3 — CID 101076081
(4-bromophenyl)-(1-methyl-2,3-dihydroindol-5-yl)diazene (PubChem CID 101076081) has the molecular formula C15H14BrN3 and a molecular weight of 316.20 g/mol. Its IUPAC name is (4-bromophenyl)-(1-methyl-2,3-dihydroindol-5-yl)diazene.
| Compound Name | (4-bromophenyl)-(1-methyl-2,3-dihydroindol-5-yl)diazene |
|---|---|
| PubChem CID | 101076081 |
| Molecular Formula | C15H14BrN3 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | (4-bromophenyl)-(1-methyl-2,3-dihydroindol-5-yl)diazene |
| SMILES | CN1CCc2cc(/N=N/c3ccc(Br)cc3)ccc21 |
| InChI | InChI=1S/C15H14BrN3/c1-19-9-8-11-10-14(6-7-15(11)19)18-17-13-4-2-12(16)3-5-13/h2-7,10H,8-9H2,1H3/b18-17+ |
| InChIKey | DAEGLCGGQZJURU-ISLYRVAYSA-N |
| XLogP | 4.86 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|