C11H16N2 — CID 82539913
N-ethyl-1-methyl-2,3-dihydroindol-5-amine (PubChem CID 82539913) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is N-ethyl-1-methyl-2,3-dihydroindol-5-amine.
| Compound Name | N-ethyl-1-methyl-2,3-dihydroindol-5-amine |
|---|---|
| PubChem CID | 82539913 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | N-ethyl-1-methyl-2,3-dihydroindol-5-amine |
| SMILES | CCNc1ccc2c(c1)CCN2C |
| InChI | InChI=1S/C11H16N2/c1-3-12-10-4-5-11-9(8-10)6-7-13(11)2/h4-5,8,12H,3,6-7H2,1-2H3 |
| InChIKey | DFSSJDXXLYWKDK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|