C15H22N2O2 — CID 82539115
6-[(1-methyl-2,3-dihydroindol-5-yl)amino]hexanoic acid (PubChem CID 82539115) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 6-[(1-methyl-2,3-dihydroindol-5-yl)amino]hexanoic acid.
| Compound Name | 6-[(1-methyl-2,3-dihydroindol-5-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 82539115 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 6-[(1-methyl-2,3-dihydroindol-5-yl)amino]hexanoic acid |
| SMILES | CN1CCc2cc(NCCCCCC(=O)O)ccc21 |
| InChI | InChI=1S/C15H22N2O2/c1-17-10-8-12-11-13(6-7-14(12)17)16-9-4-2-3-5-15(18)19/h6-7,11,16H,2-5,8-10H2,1H3,(H,18,19) |
| InChIKey | HJKRVMBGRWISOG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|